Name | cucurbit(5)uril |
Synonyms | Cucurbit[5]uril cucurbit(5)uril Curcubit[5]uril Cucurbit[5]uril hydrate Cucurbit[5]uril hydrate contains acid of crystalization |
CAS | 259886-49-2 |
InChI | InChI=1S/C30H30N20O10/c51-21-31-1-32-12-14-36(22(32)52)4-40-16-18-44(26(40)56)8-48-20-19-47(29(48)59)7-43-17-15-39(25(43)55)3-35(21)13-11(31)33-2-34(12)24(54)38(14)6-42(16)28(58)46(18)10-50(20)30(60)49(19)9-45(17)27(57)41(15)5-37(13)23(33)53/h11-20H,1-10H2/t11-,12+,13+,14-,15-,16+,17+,18-,19-,20+ |
Molecular Formula | C30H30N20O10 |
Molar Mass | 830.69 |
Density | 2.62 |
Water Solubility | 340.6mg/L(25 ºC) |
Solubility | Pure water is almost insoluble, soluble in inorganic salt water (concentration about 0.1M) solution or strong acid, such as hydrochloric acid and sulfuric acid above 20%, the process is relatively slow, increasing the amount of acid or heating at 50 ℃ will dissolve faster. If it forms molecules with other organic matter, it cannot be dissolved after assembly. |
Appearance | solid |
Color | white |
pKa | -0.08±0.20(Predicted) |
Storage Condition | Room Temprature |
WGK Germany | 3 |
use | host material for supramolecular chemistry. |